C18H20N4O2 — CID 36657770
2-[2-(2,5-dimethylphenoxy)ethyl]-5-(3-methoxyphenyl)tetrazole (PubChem CID 36657770) has the molecular formula C18H20N4O2 and a molecular weight of 324.38 g/mol. Its IUPAC name is 2-[2-(2,5-dimethylphenoxy)ethyl]-5-(3-methoxyphenyl)tetrazole.
| Compound Name | 2-[2-(2,5-dimethylphenoxy)ethyl]-5-(3-methoxyphenyl)tetrazole |
|---|---|
| PubChem CID | 36657770 |
| Molecular Formula | C18H20N4O2 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.16 |
| IUPAC Name | 2-[2-(2,5-dimethylphenoxy)ethyl]-5-(3-methoxyphenyl)tetrazole |
| SMILES | COc1cccc(-c2nnn(CCOc3cc(C)ccc3C)n2)c1 |
| InChI | InChI=1S/C18H20N4O2/c1-13-7-8-14(2)17(11-13)24-10-9-22-20-18(19-21-22)15-5-4-6-16(12-15)23-3/h4-8,11-12H,9-10H2,1-3H3 |
| InChIKey | WJHTWMLMNNHHBJ-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 62.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |