C18H15N5O3 — CID 17452041
2-[2-[5-(3-methoxyphenyl)tetrazol-2-yl]ethyl]isoindole-1,3-dione (PubChem CID 17452041) has the molecular formula C18H15N5O3 and a molecular weight of 349.35 g/mol. Its IUPAC name is 2-[2-[5-(3-methoxyphenyl)tetrazol-2-yl]ethyl]isoindole-1,3-dione.
| Compound Name | 2-[2-[5-(3-methoxyphenyl)tetrazol-2-yl]ethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 17452041 |
| Molecular Formula | C18H15N5O3 |
| Molecular Weight | 349.35 g/mol |
| Exact Mass | 349.12 |
| IUPAC Name | 2-[2-[5-(3-methoxyphenyl)tetrazol-2-yl]ethyl]isoindole-1,3-dione |
| SMILES | COc1cccc(-c2nnn(CCN3C(=O)c4ccccc4C3=O)n2)c1 |
| InChI | InChI=1S/C18H15N5O3/c1-26-13-6-4-5-12(11-13)16-19-21-23(20-16)10-9-22-17(24)14-7-2-3-8-15(14)18(22)25/h2-8,11H,9-10H2,1H3 |
| InChIKey | VLSRPQMXSWFLCF-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 90.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.35 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|