C22H20N4O3 — CID 7467433
5-(3,4-dimethoxyphenyl)-2-[(2-phenoxyphenyl)methyl]tetrazole (PubChem CID 7467433) has the molecular formula C22H20N4O3 and a molecular weight of 388.43 g/mol. Its IUPAC name is 5-(3,4-dimethoxyphenyl)-2-[(2-phenoxyphenyl)methyl]tetrazole.
| Compound Name | 5-(3,4-dimethoxyphenyl)-2-[(2-phenoxyphenyl)methyl]tetrazole |
|---|---|
| PubChem CID | 7467433 |
| Molecular Formula | C22H20N4O3 |
| Molecular Weight | 388.43 g/mol |
| Exact Mass | 388.15 |
| IUPAC Name | 5-(3,4-dimethoxyphenyl)-2-[(2-phenoxyphenyl)methyl]tetrazole |
| SMILES | COc1ccc(-c2nnn(Cc3ccccc3Oc3ccccc3)n2)cc1OC |
| InChI | InChI=1S/C22H20N4O3/c1-27-20-13-12-16(14-21(20)28-2)22-23-25-26(24-22)15-17-8-6-7-11-19(17)29-18-9-4-3-5-10-18/h3-14H,15H2,1-2H3 |
| InChIKey | HEABFTJNQNOGIE-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 71.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.43 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |