C16H14BrFN4O2 — CID 55499439
2-[(2-bromo-4-fluorophenyl)methyl]-5-(3,4-dimethoxyphenyl)tetrazole (PubChem CID 55499439) has the molecular formula C16H14BrFN4O2 and a molecular weight of 393.22 g/mol. Its IUPAC name is 2-[(2-bromo-4-fluorophenyl)methyl]-5-(3,4-dimethoxyphenyl)tetrazole.
| Compound Name | 2-[(2-bromo-4-fluorophenyl)methyl]-5-(3,4-dimethoxyphenyl)tetrazole |
|---|---|
| PubChem CID | 55499439 |
| Molecular Formula | C16H14BrFN4O2 |
| Molecular Weight | 393.22 g/mol |
| Exact Mass | 392.03 |
| IUPAC Name | 2-[(2-bromo-4-fluorophenyl)methyl]-5-(3,4-dimethoxyphenyl)tetrazole |
| SMILES | COc1ccc(-c2nnn(Cc3ccc(F)cc3Br)n2)cc1OC |
| InChI | InChI=1S/C16H14BrFN4O2/c1-23-14-6-4-10(7-15(14)24-2)16-19-21-22(20-16)9-11-3-5-12(18)8-13(11)17/h3-8H,9H2,1-2H3 |
| InChIKey | LRDQMYJNRGLXGX-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 62.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.22 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |