C28H38N6O5S — CID 142186041
4-[[4-[3-[5-(3,4-dimethoxyphenyl)tetrazol-2-yl]propoxy]phenyl]-methylidene-λ4-sulfanyl]-1-(2-methoxyethyl)piperidine-4-carboxamide (PubChem CID 142186041) has the molecular formula C28H38N6O5S and a molecular weight of 570.72 g/mol. Its IUPAC name is 4-[[4-[3-[5-(3,4-dimethoxyphenyl)tetrazol-2-yl]propoxy]phenyl]-methylidene-λ4-sulfanyl]-1-(2-methoxyethyl)piperidine-4-carboxamide.
| Compound Name | 4-[[4-[3-[5-(3,4-dimethoxyphenyl)tetrazol-2-yl]propoxy]phenyl]-methylidene-λ4-sulfanyl]-1-(2-methoxyethyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 142186041 |
| Molecular Formula | C28H38N6O5S |
| Molecular Weight | 570.72 g/mol |
| Exact Mass | 570.26 |
| IUPAC Name | 4-[[4-[3-[5-(3,4-dimethoxyphenyl)tetrazol-2-yl]propoxy]phenyl]-methylidene-λ4-sulfanyl]-1-(2-methoxyethyl)piperidine-4-carboxamide |
| SMILES | C=S(c1ccc(OCCCn2nnc(-c3ccc(OC)c(OC)c3)n2)cc1)C1(C(N)=O)CCN(CCOC)CC1 |
| InChI | InChI=1S/C28H38N6O5S/c1-36-19-17-33-15-12-28(13-16-33,27(29)35)40(4)23-9-7-22(8-10-23)39-18-5-14-34-31-26(30-32-34)21-6-11-24(37-2)25(20-21)38-3/h6-11,20H,4-5,12-19H2,1-3H3,(H2,29,35) |
| InChIKey | JSWCEDKNPRVHBV-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 126.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.72 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|