C15H15NO3 — CID 91406390
methyl 1-(3,4-dimethylphenyl)-2-oxopyridine-4-carboxylate (PubChem CID 91406390) has the molecular formula C15H15NO3 and a molecular weight of 257.29 g/mol. Its IUPAC name is methyl 1-(3,4-dimethylphenyl)-2-oxopyridine-4-carboxylate.
| Compound Name | methyl 1-(3,4-dimethylphenyl)-2-oxopyridine-4-carboxylate |
|---|---|
| PubChem CID | 91406390 |
| Molecular Formula | C15H15NO3 |
| Molecular Weight | 257.29 g/mol |
| Exact Mass | 257.11 |
| IUPAC Name | methyl 1-(3,4-dimethylphenyl)-2-oxopyridine-4-carboxylate |
| SMILES | COC(=O)c1ccn(-c2ccc(C)c(C)c2)c(=O)c1 |
| InChI | InChI=1S/C15H15NO3/c1-10-4-5-13(8-11(10)2)16-7-6-12(9-14(16)17)15(18)19-3/h4-9H,1-3H3 |
| InChIKey | LICYPFZUSJXNFN-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 48.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.29 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |