C14H15N3O4 — CID 7184649
dimethyl 1-(3,4-dimethylphenyl)triazole-4,5-dicarboxylate (PubChem CID 7184649) has the molecular formula C14H15N3O4 and a molecular weight of 289.29 g/mol. Its IUPAC name is dimethyl 1-(3,4-dimethylphenyl)triazole-4,5-dicarboxylate.
| Compound Name | dimethyl 1-(3,4-dimethylphenyl)triazole-4,5-dicarboxylate |
|---|---|
| PubChem CID | 7184649 |
| Molecular Formula | C14H15N3O4 |
| Molecular Weight | 289.29 g/mol |
| Exact Mass | 289.11 |
| IUPAC Name | dimethyl 1-(3,4-dimethylphenyl)triazole-4,5-dicarboxylate |
| SMILES | COC(=O)c1nnn(-c2ccc(C)c(C)c2)c1C(=O)OC |
| InChI | InChI=1S/C14H15N3O4/c1-8-5-6-10(7-9(8)2)17-12(14(19)21-4)11(15-16-17)13(18)20-3/h5-7H,1-4H3 |
| InChIKey | DRZRPLRVOIALGK-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 83.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.29 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |