C15H13N5O4 — CID 10568190
dimethyl 1-(5-phenyl-1H-pyrazol-3-yl)triazole-4,5-dicarboxylate (PubChem CID 10568190) has the molecular formula C15H13N5O4 and a molecular weight of 327.30 g/mol. Its IUPAC name is dimethyl 1-(5-phenyl-1H-pyrazol-3-yl)triazole-4,5-dicarboxylate.
| Compound Name | dimethyl 1-(5-phenyl-1H-pyrazol-3-yl)triazole-4,5-dicarboxylate |
|---|---|
| PubChem CID | 10568190 |
| Molecular Formula | C15H13N5O4 |
| Molecular Weight | 327.30 g/mol |
| Exact Mass | 327.10 |
| IUPAC Name | dimethyl 1-(5-phenyl-1H-pyrazol-3-yl)triazole-4,5-dicarboxylate |
| SMILES | COC(=O)c1nnn(-c2cc(-c3ccccc3)[nH]n2)c1C(=O)OC |
| InChI | InChI=1S/C15H13N5O4/c1-23-14(21)12-13(15(22)24-2)20(19-18-12)11-8-10(16-17-11)9-6-4-3-5-7-9/h3-8H,1-2H3,(H,16,17) |
| InChIKey | WLAHKXSLRIINNF-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 111.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.30 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |