C14H15N3O5 — CID 14223190
dimethyl 1-(phenylmethoxymethyl)triazole-4,5-dicarboxylate (PubChem CID 14223190) has the molecular formula C14H15N3O5 and a molecular weight of 305.29 g/mol. Its IUPAC name is dimethyl 1-(phenylmethoxymethyl)triazole-4,5-dicarboxylate.
| Compound Name | dimethyl 1-(phenylmethoxymethyl)triazole-4,5-dicarboxylate |
|---|---|
| PubChem CID | 14223190 |
| Molecular Formula | C14H15N3O5 |
| Molecular Weight | 305.29 g/mol |
| Exact Mass | 305.10 |
| IUPAC Name | dimethyl 1-(phenylmethoxymethyl)triazole-4,5-dicarboxylate |
| SMILES | COC(=O)c1nnn(COCc2ccccc2)c1C(=O)OC |
| InChI | InChI=1S/C14H15N3O5/c1-20-13(18)11-12(14(19)21-2)17(16-15-11)9-22-8-10-6-4-3-5-7-10/h3-7H,8-9H2,1-2H3 |
| InChIKey | LKYFNFXWWXOXSL-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 92.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.29 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |