C30H31N3O5 — CID 101197728
methyl (4R,5R,6R,7R)-7-methyl-4,5,6-tris(phenylmethoxy)-4,5,6,7-tetrahydrotriazolo[1,5-a]pyridine-3-carboxylate (PubChem CID 101197728) has the molecular formula C30H31N3O5 and a molecular weight of 513.59 g/mol. Its IUPAC name is methyl (4R,5R,6R,7R)-7-methyl-4,5,6-tris(phenylmethoxy)-4,5,6,7-tetrahydrotriazolo[1,5-a]pyridine-3-carboxylate.
| Compound Name | methyl (4R,5R,6R,7R)-7-methyl-4,5,6-tris(phenylmethoxy)-4,5,6,7-tetrahydrotriazolo[1,5-a]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 101197728 |
| Molecular Formula | C30H31N3O5 |
| Molecular Weight | 513.59 g/mol |
| Exact Mass | 513.23 |
| IUPAC Name | methyl (4R,5R,6R,7R)-7-methyl-4,5,6-tris(phenylmethoxy)-4,5,6,7-tetrahydrotriazolo[1,5-a]pyridine-3-carboxylate |
| SMILES | COC(=O)c1nnn2c1[C@@H](OCc1ccccc1)[C@H](OCc1ccccc1)[C@H](OCc1ccccc1)[C@H]2C |
| InChI | InChI=1S/C30H31N3O5/c1-21-27(36-18-22-12-6-3-7-13-22)29(38-20-24-16-10-5-11-17-24)28(37-19-23-14-8-4-9-15-23)26-25(30(34)35-2)31-32-33(21)26/h3-17,21,27-29H,18-20H2,1-2H3/t21-,27-,28-,29-/m1/s1 |
| InChIKey | GNHHMWIDWKILOX-MQTVTHGDSA-N |
| XLogP | 5.07 |
| TPSA | 84.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.59 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |