C12H13N5O3 — CID 4610938
methyl 5-amino-1-(2-anilino-2-oxoethyl)triazole-4-carboxylate (PubChem CID 4610938) has the molecular formula C12H13N5O3 and a molecular weight of 275.27 g/mol. Its IUPAC name is methyl 5-amino-1-(2-anilino-2-oxoethyl)triazole-4-carboxylate.
| Compound Name | methyl 5-amino-1-(2-anilino-2-oxoethyl)triazole-4-carboxylate |
|---|---|
| PubChem CID | 4610938 |
| Molecular Formula | C12H13N5O3 |
| Molecular Weight | 275.27 g/mol |
| Exact Mass | 275.10 |
| IUPAC Name | methyl 5-amino-1-(2-anilino-2-oxoethyl)triazole-4-carboxylate |
| SMILES | COC(=O)c1nnn(CC(=O)Nc2ccccc2)c1N |
| InChI | InChI=1S/C12H13N5O3/c1-20-12(19)10-11(13)17(16-15-10)7-9(18)14-8-5-3-2-4-6-8/h2-6H,7,13H2,1H3,(H,14,18) |
| InChIKey | VIGVRPXASDCTPU-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 112.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.27 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |