C21H24N6O3 — CID 7180002
5-amino-1-[2-(4-ethoxyanilino)-2-oxoethyl]-N-(2-phenylethyl)triazole-4-carboxamide (PubChem CID 7180002) has the molecular formula C21H24N6O3 and a molecular weight of 408.46 g/mol. Its IUPAC name is 5-amino-1-[2-(4-ethoxyanilino)-2-oxoethyl]-N-(2-phenylethyl)triazole-4-carboxamide.
| Compound Name | 5-amino-1-[2-(4-ethoxyanilino)-2-oxoethyl]-N-(2-phenylethyl)triazole-4-carboxamide |
|---|---|
| PubChem CID | 7180002 |
| Molecular Formula | C21H24N6O3 |
| Molecular Weight | 408.46 g/mol |
| Exact Mass | 408.19 |
| IUPAC Name | 5-amino-1-[2-(4-ethoxyanilino)-2-oxoethyl]-N-(2-phenylethyl)triazole-4-carboxamide |
| SMILES | CCOc1ccc(NC(=O)Cn2nnc(C(=O)NCCc3ccccc3)c2N)cc1 |
| InChI | InChI=1S/C21H24N6O3/c1-2-30-17-10-8-16(9-11-17)24-18(28)14-27-20(22)19(25-26-27)21(29)23-13-12-15-6-4-3-5-7-15/h3-11H,2,12-14,22H2,1H3,(H,23,29)(H,24,28) |
| InChIKey | MVWZXLWYIKIFTR-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 124.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.46 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |