C20H22N6O4 — CID 20853622
5-amino-N-(4-ethoxyphenyl)-1-[2-(4-methoxyanilino)-2-oxoethyl]triazole-4-carboxamide (PubChem CID 20853622) has the molecular formula C20H22N6O4 and a molecular weight of 410.43 g/mol. Its IUPAC name is 5-amino-N-(4-ethoxyphenyl)-1-[2-(4-methoxyanilino)-2-oxoethyl]triazole-4-carboxamide.
| Compound Name | 5-amino-N-(4-ethoxyphenyl)-1-[2-(4-methoxyanilino)-2-oxoethyl]triazole-4-carboxamide |
|---|---|
| PubChem CID | 20853622 |
| Molecular Formula | C20H22N6O4 |
| Molecular Weight | 410.43 g/mol |
| Exact Mass | 410.17 |
| IUPAC Name | 5-amino-N-(4-ethoxyphenyl)-1-[2-(4-methoxyanilino)-2-oxoethyl]triazole-4-carboxamide |
| SMILES | CCOc1ccc(NC(=O)c2nnn(CC(=O)Nc3ccc(OC)cc3)c2N)cc1 |
| InChI | InChI=1S/C20H22N6O4/c1-3-30-16-10-6-14(7-11-16)23-20(28)18-19(21)26(25-24-18)12-17(27)22-13-4-8-15(29-2)9-5-13/h4-11H,3,12,21H2,1-2H3,(H,22,27)(H,23,28) |
| InChIKey | XQHKPVINCAONJX-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 133.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.43 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |