C18H17FN6O3 — CID 20923628
5-amino-N-(4-fluorophenyl)-1-[2-(2-methoxyanilino)-2-oxoethyl]triazole-4-carboxamide (PubChem CID 20923628) has the molecular formula C18H17FN6O3 and a molecular weight of 384.37 g/mol. Its IUPAC name is 5-amino-N-(4-fluorophenyl)-1-[2-(2-methoxyanilino)-2-oxoethyl]triazole-4-carboxamide.
| Compound Name | 5-amino-N-(4-fluorophenyl)-1-[2-(2-methoxyanilino)-2-oxoethyl]triazole-4-carboxamide |
|---|---|
| PubChem CID | 20923628 |
| Molecular Formula | C18H17FN6O3 |
| Molecular Weight | 384.37 g/mol |
| Exact Mass | 384.13 |
| IUPAC Name | 5-amino-N-(4-fluorophenyl)-1-[2-(2-methoxyanilino)-2-oxoethyl]triazole-4-carboxamide |
| SMILES | COc1ccccc1NC(=O)Cn1nnc(C(=O)Nc2ccc(F)cc2)c1N |
| InChI | InChI=1S/C18H17FN6O3/c1-28-14-5-3-2-4-13(14)22-15(26)10-25-17(20)16(23-24-25)18(27)21-12-8-6-11(19)7-9-12/h2-9H,10,20H2,1H3,(H,21,27)(H,22,26) |
| InChIKey | MOBRJSOUOZBNPQ-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 124.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.37 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |