C21H24N6O4 — CID 20853662
5-amino-1-[2-(2-ethoxyanilino)-2-oxoethyl]-N-(2-ethoxyphenyl)triazole-4-carboxamide (PubChem CID 20853662) has the molecular formula C21H24N6O4 and a molecular weight of 424.46 g/mol. Its IUPAC name is 5-amino-1-[2-(2-ethoxyanilino)-2-oxoethyl]-N-(2-ethoxyphenyl)triazole-4-carboxamide.
| Compound Name | 5-amino-1-[2-(2-ethoxyanilino)-2-oxoethyl]-N-(2-ethoxyphenyl)triazole-4-carboxamide |
|---|---|
| PubChem CID | 20853662 |
| Molecular Formula | C21H24N6O4 |
| Molecular Weight | 424.46 g/mol |
| Exact Mass | 424.19 |
| IUPAC Name | 5-amino-1-[2-(2-ethoxyanilino)-2-oxoethyl]-N-(2-ethoxyphenyl)triazole-4-carboxamide |
| SMILES | CCOc1ccccc1NC(=O)Cn1nnc(C(=O)Nc2ccccc2OCC)c1N |
| InChI | InChI=1S/C21H24N6O4/c1-3-30-16-11-7-5-9-14(16)23-18(28)13-27-20(22)19(25-26-27)21(29)24-15-10-6-8-12-17(15)31-4-2/h5-12H,3-4,13,22H2,1-2H3,(H,23,28)(H,24,29) |
| InChIKey | JRDYEOGRYLBRRG-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 133.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.46 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |