C21H23N5O4 — CID 53366120
1-[2-(2-ethoxyanilino)-2-oxoethyl]-N-(2-methoxyphenyl)-5-methyltriazole-4-carboxamide (PubChem CID 53366120) has the molecular formula C21H23N5O4 and a molecular weight of 409.45 g/mol. Its IUPAC name is 1-[2-(2-ethoxyanilino)-2-oxoethyl]-N-(2-methoxyphenyl)-5-methyltriazole-4-carboxamide.
| Compound Name | 1-[2-(2-ethoxyanilino)-2-oxoethyl]-N-(2-methoxyphenyl)-5-methyltriazole-4-carboxamide |
|---|---|
| PubChem CID | 53366120 |
| Molecular Formula | C21H23N5O4 |
| Molecular Weight | 409.45 g/mol |
| Exact Mass | 409.18 |
| IUPAC Name | 1-[2-(2-ethoxyanilino)-2-oxoethyl]-N-(2-methoxyphenyl)-5-methyltriazole-4-carboxamide |
| SMILES | CCOc1ccccc1NC(=O)Cn1nnc(C(=O)Nc2ccccc2OC)c1C |
| InChI | InChI=1S/C21H23N5O4/c1-4-30-18-12-8-6-10-16(18)22-19(27)13-26-14(2)20(24-25-26)21(28)23-15-9-5-7-11-17(15)29-3/h5-12H,4,13H2,1-3H3,(H,22,27)(H,23,28) |
| InChIKey | OPKPBXMQGRZRHZ-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 107.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.45 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |