C13H14BrN5O3 — CID 112707356
methyl 5-amino-1-[2-[(2-bromophenyl)methylamino]-2-oxoethyl]triazole-4-carboxylate (PubChem CID 112707356) has the molecular formula C13H14BrN5O3 and a molecular weight of 368.19 g/mol. Its IUPAC name is methyl 5-amino-1-[2-[(2-bromophenyl)methylamino]-2-oxoethyl]triazole-4-carboxylate.
| Compound Name | methyl 5-amino-1-[2-[(2-bromophenyl)methylamino]-2-oxoethyl]triazole-4-carboxylate |
|---|---|
| PubChem CID | 112707356 |
| Molecular Formula | C13H14BrN5O3 |
| Molecular Weight | 368.19 g/mol |
| Exact Mass | 367.03 |
| IUPAC Name | methyl 5-amino-1-[2-[(2-bromophenyl)methylamino]-2-oxoethyl]triazole-4-carboxylate |
| SMILES | COC(=O)c1nnn(CC(=O)NCc2ccccc2Br)c1N |
| InChI | InChI=1S/C13H14BrN5O3/c1-22-13(21)11-12(15)19(18-17-11)7-10(20)16-6-8-4-2-3-5-9(8)14/h2-5H,6-7,15H2,1H3,(H,16,20) |
| InChIKey | AZXLIVXBBCOKTR-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 112.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.19 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |