C7H10N4O4 — CID 82209045
3-(5-amino-4-methoxycarbonyltriazol-1-yl)propanoic acid (PubChem CID 82209045) has the molecular formula C7H10N4O4 and a molecular weight of 214.18 g/mol. Its IUPAC name is 3-(5-amino-4-methoxycarbonyltriazol-1-yl)propanoic acid.
| Compound Name | 3-(5-amino-4-methoxycarbonyltriazol-1-yl)propanoic acid |
|---|---|
| PubChem CID | 82209045 |
| Molecular Formula | C7H10N4O4 |
| Molecular Weight | 214.18 g/mol |
| Exact Mass | 214.07 |
| IUPAC Name | 3-(5-amino-4-methoxycarbonyltriazol-1-yl)propanoic acid |
| SMILES | COC(=O)c1nnn(CCC(=O)O)c1N |
| InChI | InChI=1S/C7H10N4O4/c1-15-7(14)5-6(8)11(10-9-5)3-2-4(12)13/h2-3,8H2,1H3,(H,12,13) |
| InChIKey | ITCVYOPOUXPXBB-UHFFFAOYSA-N |
| XLogP | -0.88 |
| TPSA | 120.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.18 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |