C35H33BrN2O5 — CID 101131349
methyl (3R,3aS,4S,5S,6S)-2-(4-bromophenyl)-4,5,6-tris(phenylmethoxy)-3a,4,5,6-tetrahydro-3H-cyclopenta[c]pyrazole-3-carboxylate (PubChem CID 101131349) has the molecular formula C35H33BrN2O5 and a molecular weight of 641.56 g/mol. Its IUPAC name is methyl (3R,3aS,4S,5S,6S)-2-(4-bromophenyl)-4,5,6-tris(phenylmethoxy)-3a,4,5,6-tetrahydro-3H-cyclopenta[c]pyrazole-3-carboxylate.
| Compound Name | methyl (3R,3aS,4S,5S,6S)-2-(4-bromophenyl)-4,5,6-tris(phenylmethoxy)-3a,4,5,6-tetrahydro-3H-cyclopenta[c]pyrazole-3-carboxylate |
|---|---|
| PubChem CID | 101131349 |
| Molecular Formula | C35H33BrN2O5 |
| Molecular Weight | 641.56 g/mol |
| Exact Mass | 640.16 |
| IUPAC Name | methyl (3R,3aS,4S,5S,6S)-2-(4-bromophenyl)-4,5,6-tris(phenylmethoxy)-3a,4,5,6-tetrahydro-3H-cyclopenta[c]pyrazole-3-carboxylate |
| SMILES | COC(=O)[C@H]1[C@H]2C(=NN1c1ccc(Br)cc1)[C@H](OCc1ccccc1)[C@@H](OCc1ccccc1)[C@H]2OCc1ccccc1 |
| InChI | InChI=1S/C35H33BrN2O5/c1-40-35(39)31-29-30(37-38(31)28-19-17-27(36)18-20-28)33(42-22-25-13-7-3-8-14-25)34(43-23-26-15-9-4-10-16-26)32(29)41-21-24-11-5-2-6-12-24/h2-20,29,31-34H,21-23H2,1H3/t29-,31-,32+,33+,34+/m1/s1 |
| InChIKey | WDPYCDQXXPCHRA-MHJLVBFZSA-N |
| XLogP | 6.55 |
| TPSA | 69.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.56 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |