C19H18N2O4 — CID 7071906
dimethyl (3R,4R)-2,5-diphenyl-3,4-dihydropyrazole-3,4-dicarboxylate (PubChem CID 7071906) has the molecular formula C19H18N2O4 and a molecular weight of 338.36 g/mol. Its IUPAC name is dimethyl (3R,4R)-2,5-diphenyl-3,4-dihydropyrazole-3,4-dicarboxylate.
| Compound Name | dimethyl (3R,4R)-2,5-diphenyl-3,4-dihydropyrazole-3,4-dicarboxylate |
|---|---|
| PubChem CID | 7071906 |
| Molecular Formula | C19H18N2O4 |
| Molecular Weight | 338.36 g/mol |
| Exact Mass | 338.13 |
| IUPAC Name | dimethyl (3R,4R)-2,5-diphenyl-3,4-dihydropyrazole-3,4-dicarboxylate |
| SMILES | COC(=O)[C@H]1C(c2ccccc2)=NN(c2ccccc2)[C@H]1C(=O)OC |
| InChI | InChI=1S/C19H18N2O4/c1-24-18(22)15-16(13-9-5-3-6-10-13)20-21(17(15)19(23)25-2)14-11-7-4-8-12-14/h3-12,15,17H,1-2H3/t15-,17+/m0/s1 |
| InChIKey | DDSBFYRQWRIBIA-DOTOQJQBSA-N |
| XLogP | 2.24 |
| TPSA | 68.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.36 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |