C19H15Br2N3O6 — CID 98044907
dimethyl (3R,4R)-2-(2,4-dibromophenyl)-5-(4-nitrophenyl)-3,4-dihydropyrazole-3,4-dicarboxylate (PubChem CID 98044907) has the molecular formula C19H15Br2N3O6 and a molecular weight of 541.15 g/mol. Its IUPAC name is dimethyl (3R,4R)-2-(2,4-dibromophenyl)-5-(4-nitrophenyl)-3,4-dihydropyrazole-3,4-dicarboxylate.
| Compound Name | dimethyl (3R,4R)-2-(2,4-dibromophenyl)-5-(4-nitrophenyl)-3,4-dihydropyrazole-3,4-dicarboxylate |
|---|---|
| PubChem CID | 98044907 |
| Molecular Formula | C19H15Br2N3O6 |
| Molecular Weight | 541.15 g/mol |
| Exact Mass | 538.93 |
| IUPAC Name | dimethyl (3R,4R)-2-(2,4-dibromophenyl)-5-(4-nitrophenyl)-3,4-dihydropyrazole-3,4-dicarboxylate |
| SMILES | COC(=O)[C@H]1C(c2ccc([N+](=O)[O-])cc2)=NN(c2ccc(Br)cc2Br)[C@H]1C(=O)OC |
| InChI | InChI=1S/C19H15Br2N3O6/c1-29-18(25)15-16(10-3-6-12(7-4-10)24(27)28)22-23(17(15)19(26)30-2)14-8-5-11(20)9-13(14)21/h3-9,15,17H,1-2H3/t15-,17+/m0/s1 |
| InChIKey | HIWYADZTSABTQO-DOTOQJQBSA-N |
| XLogP | 3.67 |
| TPSA | 111.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.15 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|