C11H7BrN2O5 — CID 177437866
methyl 4-bromo-5-(4-nitrophenyl)-1,2-oxazole-3-carboxylate (PubChem CID 177437866) has the molecular formula C11H7BrN2O5 and a molecular weight of 327.09 g/mol. Its IUPAC name is methyl 4-bromo-5-(4-nitrophenyl)-1,2-oxazole-3-carboxylate.
| Compound Name | methyl 4-bromo-5-(4-nitrophenyl)-1,2-oxazole-3-carboxylate |
|---|---|
| PubChem CID | 177437866 |
| Molecular Formula | C11H7BrN2O5 |
| Molecular Weight | 327.09 g/mol |
| Exact Mass | 325.95 |
| IUPAC Name | methyl 4-bromo-5-(4-nitrophenyl)-1,2-oxazole-3-carboxylate |
| SMILES | COC(=O)c1noc(-c2ccc([N+](=O)[O-])cc2)c1Br |
| InChI | InChI=1S/C11H7BrN2O5/c1-18-11(15)9-8(12)10(19-13-9)6-2-4-7(5-3-6)14(16)17/h2-5H,1H3 |
| InChIKey | JXENLTZBJZOPTE-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 95.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.09 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|