C18H13BrN2O6 — CID 154996526
[5-(4-bromophenyl)-3-methyl-1,2-oxazol-4-yl]methyl (4-nitrophenyl) carbonate (PubChem CID 154996526) has the molecular formula C18H13BrN2O6 and a molecular weight of 433.21 g/mol. Its IUPAC name is [5-(4-bromophenyl)-3-methyl-1,2-oxazol-4-yl]methyl (4-nitrophenyl) carbonate.
| Compound Name | [5-(4-bromophenyl)-3-methyl-1,2-oxazol-4-yl]methyl (4-nitrophenyl) carbonate |
|---|---|
| PubChem CID | 154996526 |
| Molecular Formula | C18H13BrN2O6 |
| Molecular Weight | 433.21 g/mol |
| Exact Mass | 432.00 |
| IUPAC Name | [5-(4-bromophenyl)-3-methyl-1,2-oxazol-4-yl]methyl (4-nitrophenyl) carbonate |
| SMILES | Cc1noc(-c2ccc(Br)cc2)c1COC(=O)Oc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C18H13BrN2O6/c1-11-16(17(27-20-11)12-2-4-13(19)5-3-12)10-25-18(22)26-15-8-6-14(7-9-15)21(23)24/h2-9H,10H2,1H3 |
| InChIKey | ZPRPHLZRGVEONS-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 104.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.21 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|