C35H24Br2N4O9 — CID 154637272
bis[2-[[5-(4-bromophenyl)-3-methyl-1,2-oxazol-4-yl]methyl]-4-nitrophenyl] carbonate (PubChem CID 154637272) has the molecular formula C35H24Br2N4O9 and a molecular weight of 804.40 g/mol. Its IUPAC name is bis[2-[[5-(4-bromophenyl)-3-methyl-1,2-oxazol-4-yl]methyl]-4-nitrophenyl] carbonate.
| Compound Name | bis[2-[[5-(4-bromophenyl)-3-methyl-1,2-oxazol-4-yl]methyl]-4-nitrophenyl] carbonate |
|---|---|
| PubChem CID | 154637272 |
| Molecular Formula | C35H24Br2N4O9 |
| Molecular Weight | 804.40 g/mol |
| Exact Mass | 801.99 |
| IUPAC Name | bis[2-[[5-(4-bromophenyl)-3-methyl-1,2-oxazol-4-yl]methyl]-4-nitrophenyl] carbonate |
| SMILES | Cc1noc(-c2ccc(Br)cc2)c1Cc1cc([N+](=O)[O-])ccc1OC(=O)Oc1ccc([N+](=O)[O-])cc1Cc1c(C)noc1-c1ccc(Br)cc1 |
| InChI | InChI=1S/C35H24Br2N4O9/c1-19-29(33(49-38-19)21-3-7-25(36)8-4-21)17-23-15-27(40(43)44)11-13-31(23)47-35(42)48-32-14-12-28(41(45)46)16-24(32)18-30-20(2)39-50-34(30)22-5-9-26(37)10-6-22/h3-16H,17-18H2,1-2H3 |
| InChIKey | MJMRKPZOTRFTDV-UHFFFAOYSA-N |
| XLogP | 9.71 |
| TPSA | 173.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 804.40 |
| LogP ≤ 5 | 9.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|