C23H22N4O9 — CID 155165477
3-[5-[3-methyl-4-[(4-nitrophenoxy)carbonyloxymethyl]-1,2-oxazol-5-yl]pyrazin-2-yl]oxycyclohexane-1-carboxylic acid (PubChem CID 155165477) has the molecular formula C23H22N4O9 and a molecular weight of 498.45 g/mol. Its IUPAC name is 3-[5-[3-methyl-4-[(4-nitrophenoxy)carbonyloxymethyl]-1,2-oxazol-5-yl]pyrazin-2-yl]oxycyclohexane-1-carboxylic acid.
| Compound Name | 3-[5-[3-methyl-4-[(4-nitrophenoxy)carbonyloxymethyl]-1,2-oxazol-5-yl]pyrazin-2-yl]oxycyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 155165477 |
| Molecular Formula | C23H22N4O9 |
| Molecular Weight | 498.45 g/mol |
| Exact Mass | 498.14 |
| IUPAC Name | 3-[5-[3-methyl-4-[(4-nitrophenoxy)carbonyloxymethyl]-1,2-oxazol-5-yl]pyrazin-2-yl]oxycyclohexane-1-carboxylic acid |
| SMILES | Cc1noc(-c2cnc(OC3CCCC(C(=O)O)C3)cn2)c1COC(=O)Oc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C23H22N4O9/c1-13-18(12-33-23(30)35-16-7-5-15(6-8-16)27(31)32)21(36-26-13)19-10-25-20(11-24-19)34-17-4-2-3-14(9-17)22(28)29/h5-8,10-11,14,17H,2-4,9,12H2,1H3,(H,28,29) |
| InChIKey | QEYYSIYYZTXDEL-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 177.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.45 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|