C28H28N2O9 — CID 163282766
ethyl 2-[4-[3-methyl-4-[(4-nitrophenoxy)carbonyloxymethyl]-1,2-oxazol-5-yl]phenoxy]bicyclo[4.1.0]heptane-7-carboxylate (PubChem CID 163282766) has the molecular formula C28H28N2O9 and a molecular weight of 536.54 g/mol. Its IUPAC name is ethyl 2-[4-[3-methyl-4-[(4-nitrophenoxy)carbonyloxymethyl]-1,2-oxazol-5-yl]phenoxy]bicyclo[4.1.0]heptane-7-carboxylate.
| Compound Name | ethyl 2-[4-[3-methyl-4-[(4-nitrophenoxy)carbonyloxymethyl]-1,2-oxazol-5-yl]phenoxy]bicyclo[4.1.0]heptane-7-carboxylate |
|---|---|
| PubChem CID | 163282766 |
| Molecular Formula | C28H28N2O9 |
| Molecular Weight | 536.54 g/mol |
| Exact Mass | 536.18 |
| IUPAC Name | ethyl 2-[4-[3-methyl-4-[(4-nitrophenoxy)carbonyloxymethyl]-1,2-oxazol-5-yl]phenoxy]bicyclo[4.1.0]heptane-7-carboxylate |
| SMILES | CCOC(=O)C1C2CCCC(Oc3ccc(-c4onc(C)c4COC(=O)Oc4ccc([N+](=O)[O-])cc4)cc3)C21 |
| InChI | InChI=1S/C28H28N2O9/c1-3-35-27(31)25-21-5-4-6-23(24(21)25)37-19-11-7-17(8-12-19)26-22(16(2)29-39-26)15-36-28(32)38-20-13-9-18(10-14-20)30(33)34/h7-14,21,23-25H,3-6,15H2,1-2H3 |
| InChIKey | QOTZUPJBBFMJRN-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 140.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.54 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|