C25H25N5O8 — CID 155745524
ethyl (1S,2R,5R)-2-[[6-[1-methyl-5-[(4-nitrophenoxy)carbonyloxymethyl]triazol-4-yl]-3-pyridinyl]oxy]bicyclo[3.1.0]hexane-6-carboxylate (PubChem CID 155745524) has the molecular formula C25H25N5O8 and a molecular weight of 523.50 g/mol. Its IUPAC name is ethyl (1S,2R,5R)-2-[[6-[1-methyl-5-[(4-nitrophenoxy)carbonyloxymethyl]triazol-4-yl]-3-pyridinyl]oxy]bicyclo[3.1.0]hexane-6-carboxylate.
| Compound Name | ethyl (1S,2R,5R)-2-[[6-[1-methyl-5-[(4-nitrophenoxy)carbonyloxymethyl]triazol-4-yl]-3-pyridinyl]oxy]bicyclo[3.1.0]hexane-6-carboxylate |
|---|---|
| PubChem CID | 155745524 |
| Molecular Formula | C25H25N5O8 |
| Molecular Weight | 523.50 g/mol |
| Exact Mass | 523.17 |
| IUPAC Name | ethyl (1S,2R,5R)-2-[[6-[1-methyl-5-[(4-nitrophenoxy)carbonyloxymethyl]triazol-4-yl]-3-pyridinyl]oxy]bicyclo[3.1.0]hexane-6-carboxylate |
| SMILES | CCOC(=O)C1[C@H]2[C@H](Oc3ccc(-c4nnn(C)c4COC(=O)Oc4ccc([N+](=O)[O-])cc4)nc3)CC[C@@H]12 |
| InChI | InChI=1S/C25H25N5O8/c1-3-35-24(31)22-17-9-11-20(21(17)22)37-16-8-10-18(26-12-16)23-19(29(2)28-27-23)13-36-25(32)38-15-6-4-14(5-7-15)30(33)34/h4-8,10,12,17,20-22H,3,9,11,13H2,1-2H3/t17-,20-,21-,22?/m1/s1 |
| InChIKey | UAISROZYEKFKMD-BRETVVRTSA-N |
| XLogP | 3.47 |
| TPSA | 157.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.50 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|