C26H27N5O8 — CID 175931169
[2-cyclopropyl-6-[1-methyl-5-[(4-nitrophenoxy)carbonyloxymethyl]triazol-4-yl]-3-pyridinyl] cyclohexanecarboperoxoate (PubChem CID 175931169) has the molecular formula C26H27N5O8 and a molecular weight of 537.53 g/mol. Its IUPAC name is [2-cyclopropyl-6-[1-methyl-5-[(4-nitrophenoxy)carbonyloxymethyl]triazol-4-yl]-3-pyridinyl] cyclohexanecarboperoxoate.
| Compound Name | [2-cyclopropyl-6-[1-methyl-5-[(4-nitrophenoxy)carbonyloxymethyl]triazol-4-yl]-3-pyridinyl] cyclohexanecarboperoxoate |
|---|---|
| PubChem CID | 175931169 |
| Molecular Formula | C26H27N5O8 |
| Molecular Weight | 537.53 g/mol |
| Exact Mass | 537.19 |
| IUPAC Name | [2-cyclopropyl-6-[1-methyl-5-[(4-nitrophenoxy)carbonyloxymethyl]triazol-4-yl]-3-pyridinyl] cyclohexanecarboperoxoate |
| SMILES | Cn1nnc(-c2ccc(OOC(=O)C3CCCCC3)c(C3CC3)n2)c1COC(=O)Oc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C26H27N5O8/c1-30-21(15-36-26(33)37-19-11-9-18(10-12-19)31(34)35)24(28-29-30)20-13-14-22(23(27-20)16-7-8-16)38-39-25(32)17-5-3-2-4-6-17/h9-14,16-17H,2-8,15H2,1H3 |
| InChIKey | CFQMFOSUTBBEGY-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 157.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.53 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|