C24H32FN5O5 — CID 166559405
[6-[5-(2-cyclobutylethylcarbamoyloxymethyl)-1-methyltriazol-4-yl]-2-(fluoromethyl)-3-pyridinyl] cyclohexanecarboperoxoate (PubChem CID 166559405) has the molecular formula C24H32FN5O5 and a molecular weight of 489.55 g/mol. Its IUPAC name is [6-[5-(2-cyclobutylethylcarbamoyloxymethyl)-1-methyltriazol-4-yl]-2-(fluoromethyl)-3-pyridinyl] cyclohexanecarboperoxoate.
| Compound Name | [6-[5-(2-cyclobutylethylcarbamoyloxymethyl)-1-methyltriazol-4-yl]-2-(fluoromethyl)-3-pyridinyl] cyclohexanecarboperoxoate |
|---|---|
| PubChem CID | 166559405 |
| Molecular Formula | C24H32FN5O5 |
| Molecular Weight | 489.55 g/mol |
| Exact Mass | 489.24 |
| IUPAC Name | [6-[5-(2-cyclobutylethylcarbamoyloxymethyl)-1-methyltriazol-4-yl]-2-(fluoromethyl)-3-pyridinyl] cyclohexanecarboperoxoate |
| SMILES | Cn1nnc(-c2ccc(OOC(=O)C3CCCCC3)c(CF)n2)c1COC(=O)NCCC1CCC1 |
| InChI | InChI=1S/C24H32FN5O5/c1-30-20(15-33-24(32)26-13-12-16-6-5-7-16)22(28-29-30)18-10-11-21(19(14-25)27-18)34-35-23(31)17-8-3-2-4-9-17/h10-11,16-17H,2-9,12-15H2,1H3,(H,26,32) |
| InChIKey | ALKGGDIHLDTDJK-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 117.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.55 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|