C26H25FN2O8S — CID 163298015
trans-methyl (1S,3S)-3-[[6-[5-fluoro-3-[(4-nitrophenoxy)carbonyloxymethyl]thiophen-2-yl]-2-methyl-3-pyridinyl]oxy]cyclohexane-1-carboxylate (PubChem CID 163298015) has the molecular formula C26H25FN2O8S and a molecular weight of 544.56 g/mol. Its IUPAC name is trans-methyl (1S,3S)-3-[[6-[5-fluoro-3-[(4-nitrophenoxy)carbonyloxymethyl]thiophen-2-yl]-2-methyl-3-pyridinyl]oxy]cyclohexane-1-carboxylate.
| Compound Name | trans-methyl (1S,3S)-3-[[6-[5-fluoro-3-[(4-nitrophenoxy)carbonyloxymethyl]thiophen-2-yl]-2-methyl-3-pyridinyl]oxy]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 163298015 |
| Molecular Formula | C26H25FN2O8S |
| Molecular Weight | 544.56 g/mol |
| Exact Mass | 544.13 |
| IUPAC Name | trans-methyl (1S,3S)-3-[[6-[5-fluoro-3-[(4-nitrophenoxy)carbonyloxymethyl]thiophen-2-yl]-2-methyl-3-pyridinyl]oxy]cyclohexane-1-carboxylate |
| SMILES | COC(=O)[C@H]1CCC[C@H](Oc2ccc(-c3sc(F)cc3COC(=O)Oc3ccc([N+](=O)[O-])cc3)nc2C)C1 |
| InChI | InChI=1S/C26H25FN2O8S/c1-15-22(36-20-5-3-4-16(12-20)25(30)34-2)11-10-21(28-15)24-17(13-23(27)38-24)14-35-26(31)37-19-8-6-18(7-9-19)29(32)33/h6-11,13,16,20H,3-5,12,14H2,1-2H3/t16-,20-/m0/s1 |
| InChIKey | OLLFDVVFMWLURC-JXFKEZNVSA-N |
| XLogP | 5.99 |
| TPSA | 127.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.56 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|