C23H22ClN3O6S — CID 167071093
[5-chloro-2-(5-cyclohexyloxy-6-methylpyrazin-2-yl)thiophen-3-yl]methyl (4-nitrophenyl) carbonate (PubChem CID 167071093) has the molecular formula C23H22ClN3O6S and a molecular weight of 503.96 g/mol. Its IUPAC name is [5-chloro-2-(5-cyclohexyloxy-6-methylpyrazin-2-yl)thiophen-3-yl]methyl (4-nitrophenyl) carbonate.
| Compound Name | [5-chloro-2-(5-cyclohexyloxy-6-methylpyrazin-2-yl)thiophen-3-yl]methyl (4-nitrophenyl) carbonate |
|---|---|
| PubChem CID | 167071093 |
| Molecular Formula | C23H22ClN3O6S |
| Molecular Weight | 503.96 g/mol |
| Exact Mass | 503.09 |
| IUPAC Name | [5-chloro-2-(5-cyclohexyloxy-6-methylpyrazin-2-yl)thiophen-3-yl]methyl (4-nitrophenyl) carbonate |
| SMILES | Cc1nc(-c2sc(Cl)cc2COC(=O)Oc2ccc([N+](=O)[O-])cc2)cnc1OC1CCCCC1 |
| InChI | InChI=1S/C23H22ClN3O6S/c1-14-22(32-17-5-3-2-4-6-17)25-12-19(26-14)21-15(11-20(24)34-21)13-31-23(28)33-18-9-7-16(8-10-18)27(29)30/h7-12,17H,2-6,13H2,1H3 |
| InChIKey | YPWUDZIEEWHRPL-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 113.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.96 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|