C29H36N6O10S — CID 175360597
trans-(1S,3S)-3-[[2-methyl-6-[1-methyl-5-[[methyl-[4-(4-nitrophenyl)sulfonyloxybutyl]carbamoyl]oxymethyl]triazol-4-yl]-3-pyridinyl]oxy]cyclohexane-1-carboxylic acid (PubChem CID 175360597) has the molecular formula C29H36N6O10S and a molecular weight of 660.71 g/mol. Its IUPAC name is trans-(1S,3S)-3-[[2-methyl-6-[1-methyl-5-[[methyl-[4-(4-nitrophenyl)sulfonyloxybutyl]carbamoyl]oxymethyl]triazol-4-yl]-3-pyridinyl]oxy]cyclohexane-1-carboxylic acid.
| Compound Name | trans-(1S,3S)-3-[[2-methyl-6-[1-methyl-5-[[methyl-[4-(4-nitrophenyl)sulfonyloxybutyl]carbamoyl]oxymethyl]triazol-4-yl]-3-pyridinyl]oxy]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 175360597 |
| Molecular Formula | C29H36N6O10S |
| Molecular Weight | 660.71 g/mol |
| Exact Mass | 660.22 |
| IUPAC Name | trans-(1S,3S)-3-[[2-methyl-6-[1-methyl-5-[[methyl-[4-(4-nitrophenyl)sulfonyloxybutyl]carbamoyl]oxymethyl]triazol-4-yl]-3-pyridinyl]oxy]cyclohexane-1-carboxylic acid |
| SMILES | Cc1nc(-c2nnn(C)c2COC(=O)N(C)CCCCOS(=O)(=O)c2ccc([N+](=O)[O-])cc2)ccc1O[C@H]1CCC[C@H](C(=O)O)C1 |
| InChI | InChI=1S/C29H36N6O10S/c1-19-26(45-22-8-6-7-20(17-22)28(36)37)14-13-24(30-19)27-25(34(3)32-31-27)18-43-29(38)33(2)15-4-5-16-44-46(41,42)23-11-9-21(10-12-23)35(39)40/h9-14,20,22H,4-8,15-18H2,1-3H3,(H,36,37)/t20-,22-/m0/s1 |
| InChIKey | OGFFPGVBRRSOOV-UNMCSNQZSA-N |
| XLogP | 3.87 |
| TPSA | 206.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.71 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|