C27H26N2O9 — CID 164831246
ethyl 2-[4-[3-methyl-4-[2-(4-nitrophenoxy)-2-oxoethoxy]-1,2-oxazol-5-yl]phenoxy]bicyclo[3.1.0]hexane-6-carboxylate (PubChem CID 164831246) has the molecular formula C27H26N2O9 and a molecular weight of 522.51 g/mol. Its IUPAC name is ethyl 2-[4-[3-methyl-4-[2-(4-nitrophenoxy)-2-oxoethoxy]-1,2-oxazol-5-yl]phenoxy]bicyclo[3.1.0]hexane-6-carboxylate.
| Compound Name | ethyl 2-[4-[3-methyl-4-[2-(4-nitrophenoxy)-2-oxoethoxy]-1,2-oxazol-5-yl]phenoxy]bicyclo[3.1.0]hexane-6-carboxylate |
|---|---|
| PubChem CID | 164831246 |
| Molecular Formula | C27H26N2O9 |
| Molecular Weight | 522.51 g/mol |
| Exact Mass | 522.16 |
| IUPAC Name | ethyl 2-[4-[3-methyl-4-[2-(4-nitrophenoxy)-2-oxoethoxy]-1,2-oxazol-5-yl]phenoxy]bicyclo[3.1.0]hexane-6-carboxylate |
| SMILES | CCOC(=O)C1C2CCC(Oc3ccc(-c4onc(C)c4OCC(=O)Oc4ccc([N+](=O)[O-])cc4)cc3)C21 |
| InChI | InChI=1S/C27H26N2O9/c1-3-34-27(31)24-20-12-13-21(23(20)24)36-18-8-4-16(5-9-18)26-25(15(2)28-38-26)35-14-22(30)37-19-10-6-17(7-11-19)29(32)33/h4-11,20-21,23-24H,3,12-14H2,1-2H3 |
| InChIKey | APXACZKQOWHXDN-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 140.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.51 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|