C22H17ClN4O10S2 — CID 159687066
bis((4-nitrophenyl) 1,3-thiazol-5-ylmethyl carbonate);hydrochloride (PubChem CID 159687066) has the molecular formula C22H17ClN4O10S2 and a molecular weight of 596.98 g/mol. Its IUPAC name is bis((4-nitrophenyl) 1,3-thiazol-5-ylmethyl carbonate);hydrochloride.
| Compound Name | bis((4-nitrophenyl) 1,3-thiazol-5-ylmethyl carbonate);hydrochloride |
|---|---|
| PubChem CID | 159687066 |
| Molecular Formula | C22H17ClN4O10S2 |
| Molecular Weight | 596.98 g/mol |
| Exact Mass | 596.01 |
| IUPAC Name | bis((4-nitrophenyl) 1,3-thiazol-5-ylmethyl carbonate);hydrochloride |
| SMILES | Cl.O=C(OCc1cncs1)Oc1ccc([N+](=O)[O-])cc1.O=C(OCc1cncs1)Oc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/2C11H8N2O5S.ClH/c2*14-11(17-6-10-5-12-7-19-10)18-9-3-1-8(2-4-9)13(15)16;/h2*1-5,7H,6H2;1H |
| InChIKey | MVXXJSVKVACOHS-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 183.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.98 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|