C12H13N3O3S — CID 115732409
2-(4-nitrophenoxy)-N-(1,3-thiazol-5-ylmethyl)ethanamine (PubChem CID 115732409) has the molecular formula C12H13N3O3S and a molecular weight of 279.32 g/mol. Its IUPAC name is 2-(4-nitrophenoxy)-N-(1,3-thiazol-5-ylmethyl)ethanamine.
| Compound Name | 2-(4-nitrophenoxy)-N-(1,3-thiazol-5-ylmethyl)ethanamine |
|---|---|
| PubChem CID | 115732409 |
| Molecular Formula | C12H13N3O3S |
| Molecular Weight | 279.32 g/mol |
| Exact Mass | 279.07 |
| IUPAC Name | 2-(4-nitrophenoxy)-N-(1,3-thiazol-5-ylmethyl)ethanamine |
| SMILES | O=[N+]([O-])c1ccc(OCCNCc2cncs2)cc1 |
| InChI | InChI=1S/C12H13N3O3S/c16-15(17)10-1-3-11(4-2-10)18-6-5-13-7-12-8-14-9-19-12/h1-4,8-9,13H,5-7H2 |
| InChIKey | UZCLSIFAIQWAHJ-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 77.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.32 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|