C10H12F2N2O3 — CID 113303726
2,2-difluoro-N-[2-(4-nitrophenoxy)ethyl]ethanamine (PubChem CID 113303726) has the molecular formula C10H12F2N2O3 and a molecular weight of 246.21 g/mol. Its IUPAC name is 2,2-difluoro-N-[2-(4-nitrophenoxy)ethyl]ethanamine.
| Compound Name | 2,2-difluoro-N-[2-(4-nitrophenoxy)ethyl]ethanamine |
|---|---|
| PubChem CID | 113303726 |
| Molecular Formula | C10H12F2N2O3 |
| Molecular Weight | 246.21 g/mol |
| Exact Mass | 246.08 |
| IUPAC Name | 2,2-difluoro-N-[2-(4-nitrophenoxy)ethyl]ethanamine |
| SMILES | O=[N+]([O-])c1ccc(OCCNCC(F)F)cc1 |
| InChI | InChI=1S/C10H12F2N2O3/c11-10(12)7-13-5-6-17-9-3-1-8(2-4-9)14(15)16/h1-4,10,13H,5-7H2 |
| InChIKey | KPPDCVZOXIWQEJ-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.21 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|