C12H11NO5S — CID 54436622
(3-hydroxy-4-methoxyphenyl) 1,3-thiazol-5-ylmethyl carbonate (PubChem CID 54436622) has the molecular formula C12H11NO5S and a molecular weight of 281.29 g/mol. Its IUPAC name is (3-hydroxy-4-methoxyphenyl) 1,3-thiazol-5-ylmethyl carbonate.
| Compound Name | (3-hydroxy-4-methoxyphenyl) 1,3-thiazol-5-ylmethyl carbonate |
|---|---|
| PubChem CID | 54436622 |
| Molecular Formula | C12H11NO5S |
| Molecular Weight | 281.29 g/mol |
| Exact Mass | 281.04 |
| IUPAC Name | (3-hydroxy-4-methoxyphenyl) 1,3-thiazol-5-ylmethyl carbonate |
| SMILES | COc1ccc(OC(=O)OCc2cncs2)cc1O |
| InChI | InChI=1S/C12H11NO5S/c1-16-11-3-2-8(4-10(11)14)18-12(15)17-6-9-5-13-7-19-9/h2-5,7,14H,6H2,1H3 |
| InChIKey | WLELWNRWNSYMJO-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 77.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.29 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|