C18H25NO5Si — CID 162350991
[5-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]-3-methyl-1,2-oxazol-4-yl]methyl hydrogen carbonate (PubChem CID 162350991) has the molecular formula C18H25NO5Si and a molecular weight of 363.49 g/mol. Its IUPAC name is [5-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]-3-methyl-1,2-oxazol-4-yl]methyl hydrogen carbonate.
| Compound Name | [5-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]-3-methyl-1,2-oxazol-4-yl]methyl hydrogen carbonate |
|---|---|
| PubChem CID | 162350991 |
| Molecular Formula | C18H25NO5Si |
| Molecular Weight | 363.49 g/mol |
| Exact Mass | 363.15 |
| IUPAC Name | [5-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]-3-methyl-1,2-oxazol-4-yl]methyl hydrogen carbonate |
| SMILES | Cc1noc(-c2ccc(O[Si](C)(C)C(C)(C)C)cc2)c1COC(=O)O |
| InChI | InChI=1S/C18H25NO5Si/c1-12-15(11-22-17(20)21)16(23-19-12)13-7-9-14(10-8-13)24-25(5,6)18(2,3)4/h7-10H,11H2,1-6H3,(H,20,21) |
| InChIKey | HRZXRCAEDUNNMA-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 81.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.49 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|