C11H7N3O7 — CID 122207396
methyl 3-nitro-5-(3-nitrophenyl)-1,2-oxazole-4-carboxylate (PubChem CID 122207396) has the molecular formula C11H7N3O7 and a molecular weight of 293.19 g/mol. Its IUPAC name is methyl 3-nitro-5-(3-nitrophenyl)-1,2-oxazole-4-carboxylate.
| Compound Name | methyl 3-nitro-5-(3-nitrophenyl)-1,2-oxazole-4-carboxylate |
|---|---|
| PubChem CID | 122207396 |
| Molecular Formula | C11H7N3O7 |
| Molecular Weight | 293.19 g/mol |
| Exact Mass | 293.03 |
| IUPAC Name | methyl 3-nitro-5-(3-nitrophenyl)-1,2-oxazole-4-carboxylate |
| SMILES | COC(=O)c1c([N+](=O)[O-])noc1-c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C11H7N3O7/c1-20-11(15)8-9(21-12-10(8)14(18)19)6-3-2-4-7(5-6)13(16)17/h2-5H,1H3 |
| InChIKey | DJMCENUXBSJTRG-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 138.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.19 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|