C11H6Cl2N2O5 — CID 122207400
methyl 5-(3,4-dichlorophenyl)-3-nitro-1,2-oxazole-4-carboxylate (PubChem CID 122207400) has the molecular formula C11H6Cl2N2O5 and a molecular weight of 317.08 g/mol. Its IUPAC name is methyl 5-(3,4-dichlorophenyl)-3-nitro-1,2-oxazole-4-carboxylate.
| Compound Name | methyl 5-(3,4-dichlorophenyl)-3-nitro-1,2-oxazole-4-carboxylate |
|---|---|
| PubChem CID | 122207400 |
| Molecular Formula | C11H6Cl2N2O5 |
| Molecular Weight | 317.08 g/mol |
| Exact Mass | 315.97 |
| IUPAC Name | methyl 5-(3,4-dichlorophenyl)-3-nitro-1,2-oxazole-4-carboxylate |
| SMILES | COC(=O)c1c([N+](=O)[O-])noc1-c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C11H6Cl2N2O5/c1-19-11(16)8-9(20-14-10(8)15(17)18)5-2-3-6(12)7(13)4-5/h2-4H,1H3 |
| InChIKey | ZGEDGCRRYUFVQY-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 95.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.08 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|