C18H11Cl4NO3 — CID 131868454
ethyl 3,5-bis(3,4-dichlorophenyl)-1,2-oxazole-4-carboxylate (PubChem CID 131868454) has the molecular formula C18H11Cl4NO3 and a molecular weight of 431.10 g/mol. Its IUPAC name is ethyl 3,5-bis(3,4-dichlorophenyl)-1,2-oxazole-4-carboxylate.
| Compound Name | ethyl 3,5-bis(3,4-dichlorophenyl)-1,2-oxazole-4-carboxylate |
|---|---|
| PubChem CID | 131868454 |
| Molecular Formula | C18H11Cl4NO3 |
| Molecular Weight | 431.10 g/mol |
| Exact Mass | 428.95 |
| IUPAC Name | ethyl 3,5-bis(3,4-dichlorophenyl)-1,2-oxazole-4-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccc(Cl)c(Cl)c2)noc1-c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C18H11Cl4NO3/c1-2-25-18(24)15-16(9-3-5-11(19)13(21)7-9)23-26-17(15)10-4-6-12(20)14(22)8-10/h3-8H,2H2,1H3 |
| InChIKey | KQNBAXDSXQYRFK-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.10 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |