C12H10Cl2N2O3 — CID 91872842
ethyl 5-amino-4-(3,4-dichlorophenyl)-1,2-oxazole-3-carboxylate (PubChem CID 91872842) has the molecular formula C12H10Cl2N2O3 and a molecular weight of 301.13 g/mol. Its IUPAC name is ethyl 5-amino-4-(3,4-dichlorophenyl)-1,2-oxazole-3-carboxylate.
| Compound Name | ethyl 5-amino-4-(3,4-dichlorophenyl)-1,2-oxazole-3-carboxylate |
|---|---|
| PubChem CID | 91872842 |
| Molecular Formula | C12H10Cl2N2O3 |
| Molecular Weight | 301.13 g/mol |
| Exact Mass | 300.01 |
| IUPAC Name | ethyl 5-amino-4-(3,4-dichlorophenyl)-1,2-oxazole-3-carboxylate |
| SMILES | CCOC(=O)c1noc(N)c1-c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C12H10Cl2N2O3/c1-2-18-12(17)10-9(11(15)19-16-10)6-3-4-7(13)8(14)5-6/h3-5H,2,15H2,1H3 |
| InChIKey | SZJZXQHWJKYKGQ-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 78.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.13 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |