C17H11BrClN3O4 — CID 162643751
N-[(3-bromophenyl)methyl]-5-(4-chlorophenyl)-3-nitro-1,2-oxazole-4-carboxamide (PubChem CID 162643751) has the molecular formula C17H11BrClN3O4 and a molecular weight of 436.65 g/mol. Its IUPAC name is N-[(3-bromophenyl)methyl]-5-(4-chlorophenyl)-3-nitro-1,2-oxazole-4-carboxamide.
| Compound Name | N-[(3-bromophenyl)methyl]-5-(4-chlorophenyl)-3-nitro-1,2-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 162643751 |
| Molecular Formula | C17H11BrClN3O4 |
| Molecular Weight | 436.65 g/mol |
| Exact Mass | 434.96 |
| IUPAC Name | N-[(3-bromophenyl)methyl]-5-(4-chlorophenyl)-3-nitro-1,2-oxazole-4-carboxamide |
| SMILES | O=C(NCc1cccc(Br)c1)c1c([N+](=O)[O-])noc1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H11BrClN3O4/c18-12-3-1-2-10(8-12)9-20-17(23)14-15(26-21-16(14)22(24)25)11-4-6-13(19)7-5-11/h1-8H,9H2,(H,20,23) |
| InChIKey | MWBHSQKRVUWGPG-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 98.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.65 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|