C18H14BrClN2O2 — CID 57383727
N-[2-(3-bromophenyl)ethyl]-5-(4-chlorophenyl)-1,2-oxazole-3-carboxamide (PubChem CID 57383727) has the molecular formula C18H14BrClN2O2 and a molecular weight of 405.68 g/mol. Its IUPAC name is N-[2-(3-bromophenyl)ethyl]-5-(4-chlorophenyl)-1,2-oxazole-3-carboxamide.
| Compound Name | N-[2-(3-bromophenyl)ethyl]-5-(4-chlorophenyl)-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 57383727 |
| Molecular Formula | C18H14BrClN2O2 |
| Molecular Weight | 405.68 g/mol |
| Exact Mass | 403.99 |
| IUPAC Name | N-[2-(3-bromophenyl)ethyl]-5-(4-chlorophenyl)-1,2-oxazole-3-carboxamide |
| SMILES | O=C(NCCc1cccc(Br)c1)c1cc(-c2ccc(Cl)cc2)on1 |
| InChI | InChI=1S/C18H14BrClN2O2/c19-14-3-1-2-12(10-14)8-9-21-18(23)16-11-17(24-22-16)13-4-6-15(20)7-5-13/h1-7,10-11H,8-9H2,(H,21,23) |
| InChIKey | VVARBPPNLLBZNE-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.68 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |