C11H9BrN2O2 — CID 61410075
N-[(3-bromophenyl)methyl]-1,2-oxazole-5-carboxamide (PubChem CID 61410075) has the molecular formula C11H9BrN2O2 and a molecular weight of 281.11 g/mol. Its IUPAC name is N-[(3-bromophenyl)methyl]-1,2-oxazole-5-carboxamide.
| Compound Name | N-[(3-bromophenyl)methyl]-1,2-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 61410075 |
| Molecular Formula | C11H9BrN2O2 |
| Molecular Weight | 281.11 g/mol |
| Exact Mass | 279.98 |
| IUPAC Name | N-[(3-bromophenyl)methyl]-1,2-oxazole-5-carboxamide |
| SMILES | O=C(NCc1cccc(Br)c1)c1ccno1 |
| InChI | InChI=1S/C11H9BrN2O2/c12-9-3-1-2-8(6-9)7-13-11(15)10-4-5-14-16-10/h1-6H,7H2,(H,13,15) |
| InChIKey | QYMBCFAQPUKIGT-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.11 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |