C17H13BrClN3O — CID 46920544
N-[(3-bromophenyl)methyl]-3-(3-chlorophenyl)-1H-pyrazole-5-carboxamide (PubChem CID 46920544) has the molecular formula C17H13BrClN3O and a molecular weight of 390.67 g/mol. Its IUPAC name is N-[(3-bromophenyl)methyl]-3-(3-chlorophenyl)-1H-pyrazole-5-carboxamide.
| Compound Name | N-[(3-bromophenyl)methyl]-3-(3-chlorophenyl)-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 46920544 |
| Molecular Formula | C17H13BrClN3O |
| Molecular Weight | 390.67 g/mol |
| Exact Mass | 388.99 |
| IUPAC Name | N-[(3-bromophenyl)methyl]-3-(3-chlorophenyl)-1H-pyrazole-5-carboxamide |
| SMILES | O=C(NCc1cccc(Br)c1)c1cc(-c2cccc(Cl)c2)n[nH]1 |
| InChI | InChI=1S/C17H13BrClN3O/c18-13-5-1-3-11(7-13)10-20-17(23)16-9-15(21-22-16)12-4-2-6-14(19)8-12/h1-9H,10H2,(H,20,23)(H,21,22) |
| InChIKey | WZLZHZVAQBEAPF-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.67 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |