C19H15ClN6O — CID 47027158
3-(3-chlorophenyl)-N-[(6-pyrazol-1-yl-3-pyridinyl)methyl]-1H-pyrazole-5-carboxamide (PubChem CID 47027158) has the molecular formula C19H15ClN6O and a molecular weight of 378.82 g/mol. Its IUPAC name is 3-(3-chlorophenyl)-N-[(6-pyrazol-1-yl-3-pyridinyl)methyl]-1H-pyrazole-5-carboxamide.
| Compound Name | 3-(3-chlorophenyl)-N-[(6-pyrazol-1-yl-3-pyridinyl)methyl]-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 47027158 |
| Molecular Formula | C19H15ClN6O |
| Molecular Weight | 378.82 g/mol |
| Exact Mass | 378.10 |
| IUPAC Name | 3-(3-chlorophenyl)-N-[(6-pyrazol-1-yl-3-pyridinyl)methyl]-1H-pyrazole-5-carboxamide |
| SMILES | O=C(NCc1ccc(-n2cccn2)nc1)c1cc(-c2cccc(Cl)c2)n[nH]1 |
| InChI | InChI=1S/C19H15ClN6O/c20-15-4-1-3-14(9-15)16-10-17(25-24-16)19(27)22-12-13-5-6-18(21-11-13)26-8-2-7-23-26/h1-11H,12H2,(H,22,27)(H,24,25) |
| InChIKey | FWDBSDPALKJHIS-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 88.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.82 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |