methyl (4S)-2,5-diphenyl-3,4-dihydropyrazole-4-carboxylate

C17H16N2O2 — CID 124530326

IUPACmethyl (4S)-2,5-diphenyl-3,4-dihydropyrazole-4-carboxylate
SMILESCOC(=O)[C@H]1CN(c2ccccc2)N=C1c1ccccc1
InChIInChI=1S/C17H16N2O2/c1-21-17(20)15-12-19(14-10-6-3-7-11-14)18-16(15)13-8-4-2-5-9-13/h2-11,15H,12H2,1H3/t15-/m0/s1
InChIKeyLYINVBVYOBVQAD-HNNXBMFYSA-N
MW280.33 g/mol
LogP2.70
Rot. Bonds3

About methyl (4S)-2,5-diphenyl-3,4-dihydropyrazole-4-carboxylate

methyl (4S)-2,5-diphenyl-3,4-dihydropyrazole-4-carboxylate (PubChem CID 124530326) has the molecular formula C17H16N2O2 and a molecular weight of 280.33 g/mol. Its IUPAC name is methyl (4S)-2,5-diphenyl-3,4-dihydropyrazole-4-carboxylate.

Molecular Properties

Compound Namemethyl (4S)-2,5-diphenyl-3,4-dihydropyrazole-4-carboxylate
PubChem CID124530326
Molecular FormulaC17H16N2O2
Molecular Weight280.33 g/mol
Exact Mass280.12
IUPAC Namemethyl (4S)-2,5-diphenyl-3,4-dihydropyrazole-4-carboxylate
SMILESCOC(=O)[C@H]1CN(c2ccccc2)N=C1c1ccccc1
InChIInChI=1S/C17H16N2O2/c1-21-17(20)15-12-19(14-10-6-3-7-11-14)18-16(15)13-8-4-2-5-9-13/h2-11,15H,12H2,1H3/t15-/m0/s1
InChIKeyLYINVBVYOBVQAD-HNNXBMFYSA-N
XLogP2.70
TPSA41.90 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms21
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500280.33
LogP ≤ 52.70
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze methyl (4S)-2,5-diphenyl-3,4-dihydropyrazole-4-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl (4S)-2,5-diphenyl-3,4-dihydropyrazole-4-carboxylate?
The IUPAC name of methyl (4S)-2,5-diphenyl-3,4-dihydropyrazole-4-carboxylate (CID 124530326) is methyl (4S)-2,5-diphenyl-3,4-dihydropyrazole-4-carboxylate.
What is the SMILES notation for methyl (4S)-2,5-diphenyl-3,4-dihydropyrazole-4-carboxylate?
The canonical SMILES for methyl (4S)-2,5-diphenyl-3,4-dihydropyrazole-4-carboxylate is COC(=O)[C@H]1CN(c2ccccc2)N=C1c1ccccc1.
What is the InChIKey of methyl (4S)-2,5-diphenyl-3,4-dihydropyrazole-4-carboxylate?
The InChIKey is LYINVBVYOBVQAD-HNNXBMFYSA-N. The full InChI is InChI=1S/C17H16N2O2/c1-21-17(20)15-12-19(14-10-6-3-7-11-14)18-16(15)13-8-4-2-5-9-13/h2-11,15H,12H2,1H3/t15-/m0/s1.
What are the key properties of methyl (4S)-2,5-diphenyl-3,4-dihydropyrazole-4-carboxylate?
methyl (4S)-2,5-diphenyl-3,4-dihydropyrazole-4-carboxylate has a molecular weight of 280.33 g/mol, XLogP of 2.70, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (4S)-2,5-diphenyl-3,4-dihydropyrazole-4-carboxylate is sourced from PubChem (CID 124530326), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).