C17H16N2O2 — CID 40525014
methyl (3R)-2,5-diphenyl-3,4-dihydropyrazole-3-carboxylate (PubChem CID 40525014) has the molecular formula C17H16N2O2 and a molecular weight of 280.33 g/mol. Its IUPAC name is methyl (3R)-2,5-diphenyl-3,4-dihydropyrazole-3-carboxylate.
| Compound Name | methyl (3R)-2,5-diphenyl-3,4-dihydropyrazole-3-carboxylate |
|---|---|
| PubChem CID | 40525014 |
| Molecular Formula | C17H16N2O2 |
| Molecular Weight | 280.33 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | methyl (3R)-2,5-diphenyl-3,4-dihydropyrazole-3-carboxylate |
| SMILES | COC(=O)[C@H]1CC(c2ccccc2)=NN1c1ccccc1 |
| InChI | InChI=1S/C17H16N2O2/c1-21-17(20)16-12-15(13-8-4-2-5-9-13)18-19(16)14-10-6-3-7-11-14/h2-11,16H,12H2,1H3/t16-/m1/s1 |
| InChIKey | FUYVMLGFGPMEJH-MRXNPFEDSA-N |
| XLogP | 2.84 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.33 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |