C18H20N2O — CID 7570848
2-[(3S)-2,5-diphenyl-3,4-dihydropyrazol-3-yl]propan-2-ol (PubChem CID 7570848) has the molecular formula C18H20N2O and a molecular weight of 280.37 g/mol. Its IUPAC name is 2-[(3S)-2,5-diphenyl-3,4-dihydropyrazol-3-yl]propan-2-ol.
| Compound Name | 2-[(3S)-2,5-diphenyl-3,4-dihydropyrazol-3-yl]propan-2-ol |
|---|---|
| PubChem CID | 7570848 |
| Molecular Formula | C18H20N2O |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.16 |
| IUPAC Name | 2-[(3S)-2,5-diphenyl-3,4-dihydropyrazol-3-yl]propan-2-ol |
| SMILES | CC(C)(O)[C@@H]1CC(c2ccccc2)=NN1c1ccccc1 |
| InChI | InChI=1S/C18H20N2O/c1-18(2,21)17-13-16(14-9-5-3-6-10-14)19-20(17)15-11-7-4-8-12-15/h3-12,17,21H,13H2,1-2H3/t17-/m0/s1 |
| InChIKey | YYPJVEVRJMYYLS-KRWDZBQOSA-N |
| XLogP | 3.44 |
| TPSA | 35.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |